C17H21ClN2O — CID 19353694
3-amino-N-(4-phenylbutyl)benzamide;hydrochloride (PubChem CID 19353694) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is 3-amino-N-(4-phenylbutyl)benzamide;hydrochloride.
| Compound Name | 3-amino-N-(4-phenylbutyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 19353694 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-amino-N-(4-phenylbutyl)benzamide;hydrochloride |
| SMILES | Cl.Nc1cccc(C(=O)NCCCCc2ccccc2)c1 |
| InChI | InChI=1S/C17H20N2O.ClH/c18-16-11-6-10-15(13-16)17(20)19-12-5-4-9-14-7-2-1-3-8-14;/h1-3,6-8,10-11,13H,4-5,9,12,18H2,(H,19,20);1H |
| InChIKey | ACWALOBBKZFTPB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|