C19H25ClN2O — CID 120630670
5-amino-2-methyl-N-(5-phenylpentyl)benzamide;hydrochloride (PubChem CID 120630670) has the molecular formula C19H25ClN2O and a molecular weight of 332.88 g/mol. Its IUPAC name is 5-amino-2-methyl-N-(5-phenylpentyl)benzamide;hydrochloride.
| Compound Name | 5-amino-2-methyl-N-(5-phenylpentyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120630670 |
| Molecular Formula | C19H25ClN2O |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 5-amino-2-methyl-N-(5-phenylpentyl)benzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)NCCCCCc1ccccc1.Cl |
| InChI | InChI=1S/C19H24N2O.ClH/c1-15-11-12-17(20)14-18(15)19(22)21-13-7-3-6-10-16-8-4-2-5-9-16;/h2,4-5,8-9,11-12,14H,3,6-7,10,13,20H2,1H3,(H,21,22);1H |
| InChIKey | SHLBEQDDUQORRF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|