C23H27N5O2S — CID 46329798
N-[3-[3-[benzyl(methyl)amino]propylcarbamoyl]phenyl]-5-ethyl-1,3,4-thiadiazole-2-carboxamide (PubChem CID 46329798) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-[3-[3-[benzyl(methyl)amino]propylcarbamoyl]phenyl]-5-ethyl-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-[3-[3-[benzyl(methyl)amino]propylcarbamoyl]phenyl]-5-ethyl-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 46329798 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-[3-[3-[benzyl(methyl)amino]propylcarbamoyl]phenyl]-5-ethyl-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCc1nnc(C(=O)Nc2cccc(C(=O)NCCCN(C)Cc3ccccc3)c2)s1 |
| InChI | InChI=1S/C23H27N5O2S/c1-3-20-26-27-23(31-20)22(30)25-19-12-7-11-18(15-19)21(29)24-13-8-14-28(2)16-17-9-5-4-6-10-17/h4-7,9-12,15H,3,8,13-14,16H2,1-2H3,(H,24,29)(H,25,30) |
| InChIKey | NQMLYBMDZAQHCM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|