C15H14Cl2N2O — CID 110660973
3,4-dichloro-N-(3-pyridin-2-ylpropyl)benzamide (PubChem CID 110660973) has the molecular formula C15H14Cl2N2O and a molecular weight of 309.20 g/mol. Its IUPAC name is 3,4-dichloro-N-(3-pyridin-2-ylpropyl)benzamide.
| Compound Name | 3,4-dichloro-N-(3-pyridin-2-ylpropyl)benzamide |
|---|---|
| PubChem CID | 110660973 |
| Molecular Formula | C15H14Cl2N2O |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 3,4-dichloro-N-(3-pyridin-2-ylpropyl)benzamide |
| SMILES | O=C(NCCCc1ccccn1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H14Cl2N2O/c16-13-7-6-11(10-14(13)17)15(20)19-9-3-5-12-4-1-2-8-18-12/h1-2,4,6-8,10H,3,5,9H2,(H,19,20) |
| InChIKey | IUYZNBAWCGVPMY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|