C12H14ClN5OS — CID 87009229
1-[(6-chloro-3-pyridinyl)methyl]-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 87009229) has the molecular formula C12H14ClN5OS and a molecular weight of 311.80 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 87009229 |
| Molecular Formula | C12H14ClN5OS |
| Molecular Weight | 311.80 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCCc1nnc(NC(=O)NCc2ccc(Cl)nc2)s1 |
| InChI | InChI=1S/C12H14ClN5OS/c1-2-3-10-17-18-12(20-10)16-11(19)15-7-8-4-5-9(13)14-6-8/h4-6H,2-3,7H2,1H3,(H2,15,16,18,19) |
| InChIKey | OLLSOFSQPUTSJI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.80 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|