C14H19N5O3S2 — CID 19133972
1-[[(4-methylphenyl)sulfonylamino]methyl]-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 19133972) has the molecular formula C14H19N5O3S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-[[(4-methylphenyl)sulfonylamino]methyl]-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[[(4-methylphenyl)sulfonylamino]methyl]-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 19133972 |
| Molecular Formula | C14H19N5O3S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 1-[[(4-methylphenyl)sulfonylamino]methyl]-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCCc1nnc(NC(=O)NCNS(=O)(=O)c2ccc(C)cc2)s1 |
| InChI | InChI=1S/C14H19N5O3S2/c1-3-4-12-18-19-14(23-12)17-13(20)15-9-16-24(21,22)11-7-5-10(2)6-8-11/h5-8,16H,3-4,9H2,1-2H3,(H2,15,17,19,20) |
| InChIKey | CLZCMGFCIAPCIT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|