C17H21N5O3S — CID 98125248
1-[2-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 98125248) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is 1-[2-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[2-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 98125248 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 1-[2-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCCc1nnc(NC(=O)NCCN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)s1 |
| InChI | InChI=1S/C17H21N5O3S/c1-2-3-11-20-21-17(26-11)19-16(25)18-6-7-22-14(23)12-9-4-5-10(8-9)13(12)15(22)24/h4-5,9-10,12-13H,2-3,6-8H2,1H3,(H2,18,19,21,25)/t9-,10-,12-,13+/m0/s1 |
| InChIKey | HREDDUDGAOUIPG-XRRVDJEJSA-N |
| XLogP | 1.42 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|