C20H23N3O3 — CID 124711328
1-(2,6-dimethylphenyl)-3-[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]urea (PubChem CID 124711328) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]urea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]urea |
|---|---|
| PubChem CID | 124711328 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]urea |
| SMILES | Cc1cccc(C)c1NC(=O)NCCN1C(=O)[C@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C20H23N3O3/c1-11-4-3-5-12(2)17(11)22-20(26)21-8-9-23-18(24)15-13-6-7-14(10-13)16(15)19(23)25/h3-7,13-16H,8-10H2,1-2H3,(H2,21,22,26)/t13-,14-,15+,16+/m0/s1 |
| InChIKey | IRVRCVAZKUHFHF-CAOSSQGBSA-N |
| XLogP | 2.23 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|