C21H25N3O3 — CID 100575776
1-(2,4-dimethylphenyl)-3-[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]urea (PubChem CID 100575776) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]urea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]urea |
|---|---|
| PubChem CID | 100575776 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]urea |
| SMILES | Cc1ccc(NC(=O)NCCN2C(=O)[C@H]3[C@H](C2=O)[C@H]2C=C[C@H]3CC2)c(C)c1 |
| InChI | InChI=1S/C21H25N3O3/c1-12-3-8-16(13(2)11-12)23-21(27)22-9-10-24-19(25)17-14-4-5-15(7-6-14)18(17)20(24)26/h3-5,8,11,14-15,17-18H,6-7,9-10H2,1-2H3,(H2,22,23,27)/t14-,15-,17+,18+/m0/s1 |
| InChIKey | KGASUQSTBLWEAS-CWLKWCNXSA-N |
| XLogP | 2.62 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|