C16H20FN5 — CID 119118613
2-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-1-pyridin-2-ylguanidine (PubChem CID 119118613) has the molecular formula C16H20FN5 and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-1-pyridin-2-ylguanidine.
| Compound Name | 2-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-1-pyridin-2-ylguanidine |
|---|---|
| PubChem CID | 119118613 |
| Molecular Formula | C16H20FN5 |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-1-pyridin-2-ylguanidine |
| SMILES | CN(C)C(C/N=C(\N)Nc1ccccn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H20FN5/c1-22(2)14(12-6-8-13(17)9-7-12)11-20-16(18)21-15-5-3-4-10-19-15/h3-10,14H,11H2,1-2H3,(H3,18,19,20,21) |
| InChIKey | GPHLBSAPSUEMCK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|