C12H13F3IN5S — CID 119148362
1-pyridin-2-yl-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 119148362) has the molecular formula C12H13F3IN5S and a molecular weight of 443.24 g/mol. Its IUPAC name is 1-pyridin-2-yl-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-pyridin-2-yl-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119148362 |
| Molecular Formula | C12H13F3IN5S |
| Molecular Weight | 443.24 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | 1-pyridin-2-yl-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCc1nc(C(F)(F)F)cs1)Nc1ccccn1 |
| InChI | InChI=1S/C12H12F3N5S.HI/c13-12(14,15)8-7-21-10(19-8)4-6-18-11(16)20-9-3-1-2-5-17-9;/h1-3,5,7H,4,6H2,(H3,16,17,18,20);1H |
| InChIKey | LCNZOXKDJACNKO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|