C11H18F3IN4S — CID 111820935
1,1-diethyl-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111820935) has the molecular formula C11H18F3IN4S and a molecular weight of 422.26 g/mol. Its IUPAC name is 1,1-diethyl-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1,1-diethyl-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111820935 |
| Molecular Formula | C11H18F3IN4S |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 1,1-diethyl-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/CCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C11H17F3N4S.HI/c1-3-18(4-2)10(15)16-6-5-9-17-8(7-19-9)11(12,13)14;/h7H,3-6H2,1-2H3,(H2,15,16);1H |
| InChIKey | PKDURSOVIJFGQN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|