C18H22N4 — CID 122097073
2-[(2-phenylcyclopentyl)methyl]-1-pyridin-2-ylguanidine (PubChem CID 122097073) has the molecular formula C18H22N4 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-[(2-phenylcyclopentyl)methyl]-1-pyridin-2-ylguanidine.
| Compound Name | 2-[(2-phenylcyclopentyl)methyl]-1-pyridin-2-ylguanidine |
|---|---|
| PubChem CID | 122097073 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 2-[(2-phenylcyclopentyl)methyl]-1-pyridin-2-ylguanidine |
| SMILES | N/C(=N\CC1CCCC1c1ccccc1)Nc1ccccn1 |
| InChI | InChI=1S/C18H22N4/c19-18(22-17-11-4-5-12-20-17)21-13-15-9-6-10-16(15)14-7-2-1-3-8-14/h1-5,7-8,11-12,15-16H,6,9-10,13H2,(H3,19,20,21,22) |
| InChIKey | IIUSVNZOMDEADA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|