C15H25IN4O — CID 119147770
2-(2-cycloheptyloxyethyl)-1-pyridin-2-ylguanidine;hydroiodide (PubChem CID 119147770) has the molecular formula C15H25IN4O and a molecular weight of 404.30 g/mol. Its IUPAC name is 2-(2-cycloheptyloxyethyl)-1-pyridin-2-ylguanidine;hydroiodide.
| Compound Name | 2-(2-cycloheptyloxyethyl)-1-pyridin-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119147770 |
| Molecular Formula | C15H25IN4O |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-(2-cycloheptyloxyethyl)-1-pyridin-2-ylguanidine;hydroiodide |
| SMILES | I.N/C(=N\CCOC1CCCCCC1)Nc1ccccn1 |
| InChI | InChI=1S/C15H24N4O.HI/c16-15(19-14-9-5-6-10-17-14)18-11-12-20-13-7-3-1-2-4-8-13;/h5-6,9-10,13H,1-4,7-8,11-12H2,(H3,16,17,18,19);1H |
| InChIKey | SXQFFPUKZNAPCP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|