C13H21N5O2S — CID 120973639
2-[(1-methylsulfonylpiperidin-2-yl)methyl]-1-pyridin-2-ylguanidine (PubChem CID 120973639) has the molecular formula C13H21N5O2S and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-[(1-methylsulfonylpiperidin-2-yl)methyl]-1-pyridin-2-ylguanidine.
| Compound Name | 2-[(1-methylsulfonylpiperidin-2-yl)methyl]-1-pyridin-2-ylguanidine |
|---|---|
| PubChem CID | 120973639 |
| Molecular Formula | C13H21N5O2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-[(1-methylsulfonylpiperidin-2-yl)methyl]-1-pyridin-2-ylguanidine |
| SMILES | CS(=O)(=O)N1CCCCC1C/N=C(\N)Nc1ccccn1 |
| InChI | InChI=1S/C13H21N5O2S/c1-21(19,20)18-9-5-3-6-11(18)10-16-13(14)17-12-7-2-4-8-15-12/h2,4,7-8,11H,3,5-6,9-10H2,1H3,(H3,14,15,16,17) |
| InChIKey | UUYPWLBWMKYLHB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|