C18H22IN5O — CID 119118321
N-[3-[[[amino-(pyridin-2-ylamino)methylidene]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide (PubChem CID 119118321) has the molecular formula C18H22IN5O and a molecular weight of 451.31 g/mol. Its IUPAC name is N-[3-[[[amino-(pyridin-2-ylamino)methylidene]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide.
| Compound Name | N-[3-[[[amino-(pyridin-2-ylamino)methylidene]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 119118321 |
| Molecular Formula | C18H22IN5O |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | N-[3-[[[amino-(pyridin-2-ylamino)methylidene]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc(NC(=O)C2CCC2)c1)Nc1ccccn1 |
| InChI | InChI=1S/C18H21N5O.HI/c19-18(23-16-9-1-2-10-20-16)21-12-13-5-3-8-15(11-13)22-17(24)14-6-4-7-14;/h1-3,5,8-11,14H,4,6-7,12H2,(H,22,24)(H3,19,20,21,23);1H |
| InChIKey | KSCHJCQAPJZFEJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|