C10H13F2IN4 — CID 120514493
2-(3,3-difluorocyclobutyl)-1-pyridin-2-ylguanidine;hydroiodide (PubChem CID 120514493) has the molecular formula C10H13F2IN4 and a molecular weight of 354.14 g/mol. Its IUPAC name is 2-(3,3-difluorocyclobutyl)-1-pyridin-2-ylguanidine;hydroiodide.
| Compound Name | 2-(3,3-difluorocyclobutyl)-1-pyridin-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 120514493 |
| Molecular Formula | C10H13F2IN4 |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 2-(3,3-difluorocyclobutyl)-1-pyridin-2-ylguanidine;hydroiodide |
| SMILES | I.N/C(=N\C1CC(F)(F)C1)Nc1ccccn1 |
| InChI | InChI=1S/C10H12F2N4.HI/c11-10(12)5-7(6-10)15-9(13)16-8-3-1-2-4-14-8;/h1-4,7H,5-6H2,(H3,13,14,15,16);1H |
| InChIKey | COBANYHVZXKBKI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|