C16H17ClFIN4 — CID 120679877
2-[3-(3-chloro-4-fluorophenyl)cyclobutyl]-1-pyridin-2-ylguanidine;hydroiodide (PubChem CID 120679877) has the molecular formula C16H17ClFIN4 and a molecular weight of 446.70 g/mol. Its IUPAC name is 2-[3-(3-chloro-4-fluorophenyl)cyclobutyl]-1-pyridin-2-ylguanidine;hydroiodide.
| Compound Name | 2-[3-(3-chloro-4-fluorophenyl)cyclobutyl]-1-pyridin-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 120679877 |
| Molecular Formula | C16H17ClFIN4 |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 2-[3-(3-chloro-4-fluorophenyl)cyclobutyl]-1-pyridin-2-ylguanidine;hydroiodide |
| SMILES | I.N/C(=N\C1CC(c2ccc(F)c(Cl)c2)C1)Nc1ccccn1 |
| InChI | InChI=1S/C16H16ClFN4.HI/c17-13-9-10(4-5-14(13)18)11-7-12(8-11)21-16(19)22-15-3-1-2-6-20-15;/h1-6,9,11-12H,7-8H2,(H3,19,20,21,22);1H |
| InChIKey | MWGMBUJAIHTLPC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|