C15H12ClFO — CID 131864185
(1S,3S)-3-(3-chloro-4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol (PubChem CID 131864185) has the molecular formula C15H12ClFO and a molecular weight of 262.71 g/mol. Its IUPAC name is (1S,3S)-3-(3-chloro-4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1S,3S)-3-(3-chloro-4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 131864185 |
| Molecular Formula | C15H12ClFO |
| Molecular Weight | 262.71 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (1S,3S)-3-(3-chloro-4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol |
| SMILES | O[C@H]1C[C@@H](c2ccc(F)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C15H12ClFO/c16-13-7-9(5-6-14(13)17)12-8-15(18)11-4-2-1-3-10(11)12/h1-7,12,15,18H,8H2/t12-,15-/m0/s1 |
| InChIKey | TVQSYZONOJWHQF-WFASDCNBSA-N |
| XLogP | 4.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.71 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |