C15H12Cl2O — CID 125481378
(1R,3S)-3-(2,4-dichlorophenyl)-2,3-dihydro-1H-inden-1-ol (PubChem CID 125481378) has the molecular formula C15H12Cl2O and a molecular weight of 279.17 g/mol. Its IUPAC name is (1R,3S)-3-(2,4-dichlorophenyl)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1R,3S)-3-(2,4-dichlorophenyl)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 125481378 |
| Molecular Formula | C15H12Cl2O |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | (1R,3S)-3-(2,4-dichlorophenyl)-2,3-dihydro-1H-inden-1-ol |
| SMILES | O[C@@H]1C[C@H](c2ccc(Cl)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C15H12Cl2O/c16-9-5-6-11(14(17)7-9)13-8-15(18)12-4-2-1-3-10(12)13/h1-7,13,15,18H,8H2/t13-,15+/m0/s1 |
| InChIKey | LGOCQVHFRXXFGA-DZGCQCFKSA-N |
| XLogP | 4.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |