About (1S,3R)-7-(4-chlorophenoxy)-3-phenyl-2,3-dihydro-1H-inden-1-ol
(1S,3R)-7-(4-chlorophenoxy)-3-phenyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 1472162) has the molecular formula C21H17ClO2
and a molecular weight of 336.82 g/mol. Its IUPAC name is (1S,3R)-7-(4-chlorophenoxy)-3-phenyl-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | (1S,3R)-7-(4-chlorophenoxy)-3-phenyl-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 1472162 |
| Molecular Formula | C21H17ClO2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | (1S,3R)-7-(4-chlorophenoxy)-3-phenyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | O[C@H]1C[C@H](c2ccccc2)c2cccc(Oc3ccc(Cl)cc3)c21 |
| InChI | InChI=1S/C21H17ClO2/c22-15-9-11-16(12-10-15)24-20-8-4-7-17-18(13-19(23)21(17)20)14-5-2-1-3-6-14/h1-12,18-19,23H,13H2/t18-,19+/m1/s1 |
| InChIKey | PAQCIBLMLRKGNI-MOPGFXCFSA-N |
| XLogP | 5.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,3R)-7-(4-chlorophenoxy)-3-phenyl-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,3R)-7-(4-chlorophenoxy)-3-phenyl-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of (1S,3R)-7-(4-chlorophenoxy)-3-phenyl-2,3-dihydro-1H-inden-1-ol (CID 1472162) is (1S,3R)-7-(4-chlorophenoxy)-3-phenyl-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for (1S,3R)-7-(4-chlorophenoxy)-3-phenyl-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for (1S,3R)-7-(4-chlorophenoxy)-3-phenyl-2,3-dihydro-1H-inden-1-ol is O[C@H]1C[C@H](c2ccccc2)c2cccc(Oc3ccc(Cl)cc3)c21.
What is the InChIKey of (1S,3R)-7-(4-chlorophenoxy)-3-phenyl-2,3-dihydro-1H-inden-1-ol?
The InChIKey is PAQCIBLMLRKGNI-MOPGFXCFSA-N. The full InChI is InChI=1S/C21H17ClO2/c22-15-9-11-16(12-10-15)24-20-8-4-7-17-18(13-19(23)21(17)20)14-5-2-1-3-6-14/h1-12,18-19,23H,13H2/t18-,19+/m1/s1.
What are the key properties of (1S,3R)-7-(4-chlorophenoxy)-3-phenyl-2,3-dihydro-1H-inden-1-ol?
(1S,3R)-7-(4-chlorophenoxy)-3-phenyl-2,3-dihydro-1H-inden-1-ol has a molecular weight of 336.82 g/mol, XLogP of 5.70, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,3R)-7-(4-chlorophenoxy)-3-phenyl-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 1472162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).