C18H20ClNO3 — CID 166011973
(1R,2R,6R)-2-amino-6-[2-(4-chlorophenoxy)phenoxy]cyclohexan-1-ol (PubChem CID 166011973) has the molecular formula C18H20ClNO3 and a molecular weight of 333.82 g/mol. Its IUPAC name is (1R,2R,6R)-2-amino-6-[2-(4-chlorophenoxy)phenoxy]cyclohexan-1-ol.
| Compound Name | (1R,2R,6R)-2-amino-6-[2-(4-chlorophenoxy)phenoxy]cyclohexan-1-ol |
|---|---|
| PubChem CID | 166011973 |
| Molecular Formula | C18H20ClNO3 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | (1R,2R,6R)-2-amino-6-[2-(4-chlorophenoxy)phenoxy]cyclohexan-1-ol |
| SMILES | N[C@@H]1CCC[C@@H](Oc2ccccc2Oc2ccc(Cl)cc2)[C@@H]1O |
| InChI | InChI=1S/C18H20ClNO3/c19-12-8-10-13(11-9-12)22-15-5-1-2-6-16(15)23-17-7-3-4-14(20)18(17)21/h1-2,5-6,8-11,14,17-18,21H,3-4,7,20H2/t14-,17-,18-/m1/s1 |
| InChIKey | YNKYAWSQLBWQHJ-ZTFGCOKTSA-N |
| XLogP | 3.75 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |