C22H25NO6 — CID 110147492
4-[[(1R,2R,3R)-2-hydroxy-3-(2-phenoxyphenoxy)cyclohexyl]amino]-4-oxobutanoic acid (PubChem CID 110147492) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is 4-[[(1R,2R,3R)-2-hydroxy-3-(2-phenoxyphenoxy)cyclohexyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(1R,2R,3R)-2-hydroxy-3-(2-phenoxyphenoxy)cyclohexyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 110147492 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-[[(1R,2R,3R)-2-hydroxy-3-(2-phenoxyphenoxy)cyclohexyl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N[C@@H]1CCCC(Oc2ccccc2Oc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C22H25NO6/c24-20(13-14-21(25)26)23-16-9-6-12-19(22(16)27)29-18-11-5-4-10-17(18)28-15-7-2-1-3-8-15/h1-5,7-8,10-11,16,19,22,27H,6,9,12-14H2,(H,23,24)(H,25,26)/t16-,19?,22-/m1/s1 |
| InChIKey | MNTFTGUOMZYOCB-ZDUIXAHXSA-N |
| XLogP | 3.12 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |