C14H22N2O6 — CID 2913415
4-[[2-(3-carboxypropanoylamino)cyclohexyl]amino]-4-oxobutanoic acid (PubChem CID 2913415) has the molecular formula C14H22N2O6 and a molecular weight of 314.34 g/mol. Its IUPAC name is 4-[[2-(3-carboxypropanoylamino)cyclohexyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[2-(3-carboxypropanoylamino)cyclohexyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 2913415 |
| Molecular Formula | C14H22N2O6 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 4-[[2-(3-carboxypropanoylamino)cyclohexyl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NC1CCCCC1NC(=O)CCC(=O)O |
| InChI | InChI=1S/C14H22N2O6/c17-11(5-7-13(19)20)15-9-3-1-2-4-10(9)16-12(18)6-8-14(21)22/h9-10H,1-8H2,(H,15,17)(H,16,18)(H,19,20)(H,21,22) |
| InChIKey | KRMIVLQAOAGSSY-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |