C23H28N2O5 — CID 110157077
5-[[(1R,2S,3R)-2-hydroxy-3-(2-phenoxyanilino)cyclohexyl]amino]-5-oxopentanoic acid (PubChem CID 110157077) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 5-[[(1R,2S,3R)-2-hydroxy-3-(2-phenoxyanilino)cyclohexyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[(1R,2S,3R)-2-hydroxy-3-(2-phenoxyanilino)cyclohexyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 110157077 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 5-[[(1R,2S,3R)-2-hydroxy-3-(2-phenoxyanilino)cyclohexyl]amino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)N[C@@H]1CCC[C@@H](Nc2ccccc2Oc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C23H28N2O5/c26-21(14-7-15-22(27)28)25-19-12-6-11-18(23(19)29)24-17-10-4-5-13-20(17)30-16-8-2-1-3-9-16/h1-5,8-10,13,18-19,23-24,29H,6-7,11-12,14-15H2,(H,25,26)(H,27,28)/t18-,19-,23+/m1/s1 |
| InChIKey | MGDPQJGAYVFKAP-PWHSHALESA-N |
| XLogP | 3.54 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |