C19H24N2O2 — CID 110158483
(1R,2R,6R)-2-(methylamino)-6-(2-phenoxyanilino)cyclohexan-1-ol (PubChem CID 110158483) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is (1R,2R,6R)-2-(methylamino)-6-(2-phenoxyanilino)cyclohexan-1-ol.
| Compound Name | (1R,2R,6R)-2-(methylamino)-6-(2-phenoxyanilino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 110158483 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (1R,2R,6R)-2-(methylamino)-6-(2-phenoxyanilino)cyclohexan-1-ol |
| SMILES | CN[C@@H]1CCC[C@@H](Nc2ccccc2Oc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C19H24N2O2/c1-20-16-11-7-12-17(19(16)22)21-15-10-5-6-13-18(15)23-14-8-3-2-4-9-14/h2-6,8-10,13,16-17,19-22H,7,11-12H2,1H3/t16-,17-,19-/m1/s1 |
| InChIKey | CGVRSUSWDFQEIY-ZHALLVOQSA-N |
| XLogP | 3.39 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |