C18H22N2O2 — CID 110129018
(1R,2R,6R)-2-amino-6-(2-phenoxyanilino)cyclohexan-1-ol (PubChem CID 110129018) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (1R,2R,6R)-2-amino-6-(2-phenoxyanilino)cyclohexan-1-ol.
| Compound Name | (1R,2R,6R)-2-amino-6-(2-phenoxyanilino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 110129018 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (1R,2R,6R)-2-amino-6-(2-phenoxyanilino)cyclohexan-1-ol |
| SMILES | N[C@@H]1CCC[C@@H](Nc2ccccc2Oc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C18H22N2O2/c19-14-9-6-11-16(18(14)21)20-15-10-4-5-12-17(15)22-13-7-2-1-3-8-13/h1-5,7-8,10,12,14,16,18,20-21H,6,9,11,19H2/t14-,16-,18-/m1/s1 |
| InChIKey | LIBWCKVXPXZMRK-QGPMSJSTSA-N |
| XLogP | 3.13 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |