C17H19N2O2+ — CID 6941294
(2S)-N-(2-phenoxyphenyl)pyrrolidin-1-ium-2-carboxamide (PubChem CID 6941294) has the molecular formula C17H19N2O2+ and a molecular weight of 283.35 g/mol. Its IUPAC name is (2S)-N-(2-phenoxyphenyl)pyrrolidin-1-ium-2-carboxamide.
| Compound Name | (2S)-N-(2-phenoxyphenyl)pyrrolidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 6941294 |
| Molecular Formula | C17H19N2O2+ |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (2S)-N-(2-phenoxyphenyl)pyrrolidin-1-ium-2-carboxamide |
| SMILES | O=C(Nc1ccccc1Oc1ccccc1)[C@@H]1CCC[NH2+]1 |
| InChI | InChI=1S/C17H18N2O2/c20-17(15-10-6-12-18-15)19-14-9-4-5-11-16(14)21-13-7-2-1-3-8-13/h1-5,7-9,11,15,18H,6,10,12H2,(H,19,20)/p+1/t15-/m0/s1 |
| InChIKey | CZQGXMDJXURLDP-HNNXBMFYSA-O |
| XLogP | 2.14 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |