C16H16N2O2S — CID 43185178
N-(2-phenoxyphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 43185178) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-(2-phenoxyphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-phenoxyphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 43185178 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | N-(2-phenoxyphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1Oc1ccccc1)C1CSCN1 |
| InChI | InChI=1S/C16H16N2O2S/c19-16(14-10-21-11-17-14)18-13-8-4-5-9-15(13)20-12-6-2-1-3-7-12/h1-9,14,17H,10-11H2,(H,18,19) |
| InChIKey | BLOJTUVCAODQDZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |