C13H18N2OS — CID 43703955
N-(2-propylphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 43703955) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is N-(2-propylphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-propylphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 43703955 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-(2-propylphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCc1ccccc1NC(=O)C1CSCN1 |
| InChI | InChI=1S/C13H18N2OS/c1-2-5-10-6-3-4-7-11(10)15-13(16)12-8-17-9-14-12/h3-4,6-7,12,14H,2,5,8-9H2,1H3,(H,15,16) |
| InChIKey | SBMBGPHYHLXOAP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |