C12H16N2O2S — CID 110672368
N-[2-(2-hydroxyphenyl)ethyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 110672368) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is N-[2-(2-hydroxyphenyl)ethyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[2-(2-hydroxyphenyl)ethyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 110672368 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | N-[2-(2-hydroxyphenyl)ethyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(NCCc1ccccc1O)C1CSCN1 |
| InChI | InChI=1S/C12H16N2O2S/c15-11-4-2-1-3-9(11)5-6-13-12(16)10-7-17-8-14-10/h1-4,10,14-15H,5-8H2,(H,13,16) |
| InChIKey | NUGQXXLFRSNLIA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |