C18H18N2O3 — CID 110682205
2-oxo-N-(2-phenoxyphenyl)piperidine-4-carboxamide (PubChem CID 110682205) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-oxo-N-(2-phenoxyphenyl)piperidine-4-carboxamide.
| Compound Name | 2-oxo-N-(2-phenoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110682205 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-oxo-N-(2-phenoxyphenyl)piperidine-4-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2ccccc2Oc2ccccc2)CCN1 |
| InChI | InChI=1S/C18H18N2O3/c21-17-12-13(10-11-19-17)18(22)20-15-8-4-5-9-16(15)23-14-6-2-1-3-7-14/h1-9,13H,10-12H2,(H,19,21)(H,20,22) |
| InChIKey | ARNWCGLFOWZNAB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |