C15H12Cl2 — CID 129405682
(1R,3S)-1-chloro-3-(3-chlorophenyl)-2,3-dihydro-1H-indene (PubChem CID 129405682) has the molecular formula C15H12Cl2 and a molecular weight of 263.17 g/mol. Its IUPAC name is (1R,3S)-1-chloro-3-(3-chlorophenyl)-2,3-dihydro-1H-indene.
| Compound Name | (1R,3S)-1-chloro-3-(3-chlorophenyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 129405682 |
| Molecular Formula | C15H12Cl2 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | (1R,3S)-1-chloro-3-(3-chlorophenyl)-2,3-dihydro-1H-indene |
| SMILES | Clc1cccc([C@@H]2C[C@@H](Cl)c3ccccc32)c1 |
| InChI | InChI=1S/C15H12Cl2/c16-11-5-3-4-10(8-11)14-9-15(17)13-7-2-1-6-12(13)14/h1-8,14-15H,9H2/t14-,15+/m0/s1 |
| InChIKey | IOTSXAKXGMJHOR-LSDHHAIUSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|