C16H14ClN — CID 57273771
4-(3-chlorophenyl)-3,4-dihydro-1H-naphthalen-2-imine (PubChem CID 57273771) has the molecular formula C16H14ClN and a molecular weight of 255.75 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-3,4-dihydro-1H-naphthalen-2-imine.
| Compound Name | 4-(3-chlorophenyl)-3,4-dihydro-1H-naphthalen-2-imine |
|---|---|
| PubChem CID | 57273771 |
| Molecular Formula | C16H14ClN |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 4-(3-chlorophenyl)-3,4-dihydro-1H-naphthalen-2-imine |
| SMILES | [H]/N=C1\Cc2ccccc2C(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C16H14ClN/c17-13-6-3-5-11(8-13)16-10-14(18)9-12-4-1-2-7-15(12)16/h1-8,16,18H,9-10H2/b18-14+ |
| InChIKey | PHOMCCRDKPVCIY-NBVRZTHBSA-N |
| XLogP | 4.44 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|