C14H12ClN — CID 18675457
3-(3-chlorophenyl)-2,3-dihydro-1H-indole (PubChem CID 18675457) has the molecular formula C14H12ClN and a molecular weight of 229.71 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2,3-dihydro-1H-indole.
| Compound Name | 3-(3-chlorophenyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 18675457 |
| Molecular Formula | C14H12ClN |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 3-(3-chlorophenyl)-2,3-dihydro-1H-indole |
| SMILES | Clc1cccc(C2CNc3ccccc32)c1 |
| InChI | InChI=1S/C14H12ClN/c15-11-5-3-4-10(8-11)13-9-16-14-7-2-1-6-12(13)14/h1-8,13,16H,9H2 |
| InChIKey | UTFSCMCPVQHOJE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |