C14H12BrN — CID 177342618
5-bromo-3-phenyl-2,3-dihydro-1H-indole (PubChem CID 177342618) has the molecular formula C14H12BrN and a molecular weight of 274.16 g/mol. Its IUPAC name is 5-bromo-3-phenyl-2,3-dihydro-1H-indole.
| Compound Name | 5-bromo-3-phenyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 177342618 |
| Molecular Formula | C14H12BrN |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 5-bromo-3-phenyl-2,3-dihydro-1H-indole |
| SMILES | Brc1ccc2c(c1)C(c1ccccc1)CN2 |
| InChI | InChI=1S/C14H12BrN/c15-11-6-7-14-12(8-11)13(9-16-14)10-4-2-1-3-5-10/h1-8,13,16H,9H2 |
| InChIKey | ZPDIVDGJNRVJES-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |