C15H14BrN — CID 164550250
6-bromo-2-phenyl-1,2,3,4-tetrahydroquinoline (PubChem CID 164550250) has the molecular formula C15H14BrN and a molecular weight of 288.19 g/mol. Its IUPAC name is 6-bromo-2-phenyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-bromo-2-phenyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 164550250 |
| Molecular Formula | C15H14BrN |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 6-bromo-2-phenyl-1,2,3,4-tetrahydroquinoline |
| SMILES | Brc1ccc2c(c1)CCC(c1ccccc1)N2 |
| InChI | InChI=1S/C15H14BrN/c16-13-7-9-15-12(10-13)6-8-14(17-15)11-4-2-1-3-5-11/h1-5,7,9-10,14,17H,6,8H2 |
| InChIKey | OJVMVEZEJFEBEW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |