C15H13BrFN — CID 132589767
6-bromo-2-(3-fluorophenyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 132589767) has the molecular formula C15H13BrFN and a molecular weight of 306.18 g/mol. Its IUPAC name is 6-bromo-2-(3-fluorophenyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-bromo-2-(3-fluorophenyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 132589767 |
| Molecular Formula | C15H13BrFN |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 6-bromo-2-(3-fluorophenyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | Fc1cccc(C2CCc3cc(Br)ccc3N2)c1 |
| InChI | InChI=1S/C15H13BrFN/c16-12-5-7-15-11(8-12)4-6-14(18-15)10-2-1-3-13(17)9-10/h1-3,5,7-9,14,18H,4,6H2 |
| InChIKey | HDTHJQVJNVVWBS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |