C15H11BrF3N — CID 132589821
6-bromo-5,8-difluoro-2-(3-fluorophenyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 132589821) has the molecular formula C15H11BrF3N and a molecular weight of 342.16 g/mol. Its IUPAC name is 6-bromo-5,8-difluoro-2-(3-fluorophenyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-bromo-5,8-difluoro-2-(3-fluorophenyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 132589821 |
| Molecular Formula | C15H11BrF3N |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 6-bromo-5,8-difluoro-2-(3-fluorophenyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | Fc1cccc(C2CCc3c(F)c(Br)cc(F)c3N2)c1 |
| InChI | InChI=1S/C15H11BrF3N/c16-11-7-12(18)15-10(14(11)19)4-5-13(20-15)8-2-1-3-9(17)6-8/h1-3,6-7,13,20H,4-5H2 |
| InChIKey | WNOLRXPCNJYCCF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|