C11H13FN2O — CID 95369037
(5R,6S)-5-amino-6-(3-fluorophenyl)piperidin-2-one (PubChem CID 95369037) has the molecular formula C11H13FN2O and a molecular weight of 208.24 g/mol. Its IUPAC name is (5R,6S)-5-amino-6-(3-fluorophenyl)piperidin-2-one.
| Compound Name | (5R,6S)-5-amino-6-(3-fluorophenyl)piperidin-2-one |
|---|---|
| PubChem CID | 95369037 |
| Molecular Formula | C11H13FN2O |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | (5R,6S)-5-amino-6-(3-fluorophenyl)piperidin-2-one |
| SMILES | N[C@@H]1CCC(=O)N[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C11H13FN2O/c12-8-3-1-2-7(6-8)11-9(13)4-5-10(15)14-11/h1-3,6,9,11H,4-5,13H2,(H,14,15)/t9-,11+/m1/s1 |
| InChIKey | BPSRREZKQYQQDX-KOLCDFICSA-N |
| XLogP | 1.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |