C11H11FN2O3 — CID 138684995
[2-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]carbamic acid (PubChem CID 138684995) has the molecular formula C11H11FN2O3 and a molecular weight of 238.22 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]carbamic acid.
| Compound Name | [2-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 138684995 |
| Molecular Formula | C11H11FN2O3 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | [2-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]carbamic acid |
| SMILES | O=C(O)NC1CC(=O)NC1c1cccc(F)c1 |
| InChI | InChI=1S/C11H11FN2O3/c12-7-3-1-2-6(4-7)10-8(13-11(16)17)5-9(15)14-10/h1-4,8,10,13H,5H2,(H,14,15)(H,16,17) |
| InChIKey | DPOIXLUOGNBWQK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |