[(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid

C11H13FN2O2 — CID 71014411

IUPAC[(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid
SMILESO=C(O)N[C@H]1CNC[C@@H]1c1cccc(F)c1
InChIInChI=1S/C11H13FN2O2/c12-8-3-1-2-7(4-8)9-5-13-6-10(9)14-11(15)16/h1-4,9-10,13-14H,5-6H2,(H,15,16)/t9-,10+/m1/s1
InChIKeyJLJRTHRYIUMCCS-ZJUUUORDSA-N
MW224.23 g/mol
LogP1.15
Rot. Bonds2

About [(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid

[(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid (PubChem CID 71014411) has the molecular formula C11H13FN2O2 and a molecular weight of 224.23 g/mol. Its IUPAC name is [(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid.

Molecular Properties

Compound Name[(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid
PubChem CID71014411
Molecular FormulaC11H13FN2O2
Molecular Weight224.23 g/mol
Exact Mass224.10
IUPAC Name[(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid
SMILESO=C(O)N[C@H]1CNC[C@@H]1c1cccc(F)c1
InChIInChI=1S/C11H13FN2O2/c12-8-3-1-2-7(4-8)9-5-13-6-10(9)14-11(15)16/h1-4,9-10,13-14H,5-6H2,(H,15,16)/t9-,10+/m1/s1
InChIKeyJLJRTHRYIUMCCS-ZJUUUORDSA-N
XLogP1.15
TPSA61.36 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.23
LogP ≤ 51.15
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze [(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid?
The IUPAC name of [(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid (CID 71014411) is [(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid.
What is the SMILES notation for [(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid?
The canonical SMILES for [(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid is O=C(O)N[C@H]1CNC[C@@H]1c1cccc(F)c1.
What is the InChIKey of [(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid?
The InChIKey is JLJRTHRYIUMCCS-ZJUUUORDSA-N. The full InChI is InChI=1S/C11H13FN2O2/c12-8-3-1-2-7(4-8)9-5-13-6-10(9)14-11(15)16/h1-4,9-10,13-14H,5-6H2,(H,15,16)/t9-,10+/m1/s1.
What are the key properties of [(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid?
[(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid has a molecular weight of 224.23 g/mol, XLogP of 1.15, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid is sourced from PubChem (CID 71014411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).