C11H13FN2O2 — CID 71014411
[(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid (PubChem CID 71014411) has the molecular formula C11H13FN2O2 and a molecular weight of 224.23 g/mol. Its IUPAC name is [(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid.
| Compound Name | [(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 71014411 |
| Molecular Formula | C11H13FN2O2 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | [(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@H]1CNC[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C11H13FN2O2/c12-8-3-1-2-7(4-8)9-5-13-6-10(9)14-11(15)16/h1-4,9-10,13-14H,5-6H2,(H,15,16)/t9-,10+/m1/s1 |
| InChIKey | JLJRTHRYIUMCCS-ZJUUUORDSA-N |
| XLogP | 1.15 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |