About N-[(2R,3S)-2-(4-fluoro-3-methoxyphenyl)-5-oxopyrrolidin-3-yl]cyclopropanecarboxamide
N-[(2R,3S)-2-(4-fluoro-3-methoxyphenyl)-5-oxopyrrolidin-3-yl]cyclopropanecarboxamide (PubChem CID 138684907) has the molecular formula C15H17FN2O3
and a molecular weight of 292.31 g/mol. Its IUPAC name is N-[(2R,3S)-2-(4-fluoro-3-methoxyphenyl)-5-oxopyrrolidin-3-yl]cyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-[(2R,3S)-2-(4-fluoro-3-methoxyphenyl)-5-oxopyrrolidin-3-yl]cyclopropanecarboxamide |
| PubChem CID | 138684907 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-[(2R,3S)-2-(4-fluoro-3-methoxyphenyl)-5-oxopyrrolidin-3-yl]cyclopropanecarboxamide |
| SMILES | COc1cc([C@H]2NC(=O)C[C@@H]2NC(=O)C2CC2)ccc1F |
| InChI | InChI=1S/C15H17FN2O3/c1-21-12-6-9(4-5-10(12)16)14-11(7-13(19)18-14)17-15(20)8-2-3-8/h4-6,8,11,14H,2-3,7H2,1H3,(H,17,20)(H,18,19)/t11-,14+/m0/s1 |
| InChIKey | KUELKTJFDFSJRO-SMDDNHRTSA-N |
| XLogP | 1.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2R,3S)-2-(4-fluoro-3-methoxyphenyl)-5-oxopyrrolidin-3-yl]cyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R,3S)-2-(4-fluoro-3-methoxyphenyl)-5-oxopyrrolidin-3-yl]cyclopropanecarboxamide?
The IUPAC name of N-[(2R,3S)-2-(4-fluoro-3-methoxyphenyl)-5-oxopyrrolidin-3-yl]cyclopropanecarboxamide (CID 138684907) is N-[(2R,3S)-2-(4-fluoro-3-methoxyphenyl)-5-oxopyrrolidin-3-yl]cyclopropanecarboxamide.
What is the SMILES notation for N-[(2R,3S)-2-(4-fluoro-3-methoxyphenyl)-5-oxopyrrolidin-3-yl]cyclopropanecarboxamide?
The canonical SMILES for N-[(2R,3S)-2-(4-fluoro-3-methoxyphenyl)-5-oxopyrrolidin-3-yl]cyclopropanecarboxamide is COc1cc([C@H]2NC(=O)C[C@@H]2NC(=O)C2CC2)ccc1F.
What is the InChIKey of N-[(2R,3S)-2-(4-fluoro-3-methoxyphenyl)-5-oxopyrrolidin-3-yl]cyclopropanecarboxamide?
The InChIKey is KUELKTJFDFSJRO-SMDDNHRTSA-N. The full InChI is InChI=1S/C15H17FN2O3/c1-21-12-6-9(4-5-10(12)16)14-11(7-13(19)18-14)17-15(20)8-2-3-8/h4-6,8,11,14H,2-3,7H2,1H3,(H,17,20)(H,18,19)/t11-,14+/m0/s1.
What are the key properties of N-[(2R,3S)-2-(4-fluoro-3-methoxyphenyl)-5-oxopyrrolidin-3-yl]cyclopropanecarboxamide?
N-[(2R,3S)-2-(4-fluoro-3-methoxyphenyl)-5-oxopyrrolidin-3-yl]cyclopropanecarboxamide has a molecular weight of 292.31 g/mol, XLogP of 1.29, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R,3S)-2-(4-fluoro-3-methoxyphenyl)-5-oxopyrrolidin-3-yl]cyclopropanecarboxamide is sourced from PubChem (CID 138684907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).