C14H13N — CID 7004228
(2R)-2-phenyl-2,3-dihydro-1H-indole (PubChem CID 7004228) has the molecular formula C14H13N and a molecular weight of 195.27 g/mol. Its IUPAC name is (2R)-2-phenyl-2,3-dihydro-1H-indole.
| Compound Name | (2R)-2-phenyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 7004228 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | (2R)-2-phenyl-2,3-dihydro-1H-indole |
| SMILES | c1ccc([C@H]2Cc3ccccc3N2)cc1 |
| InChI | InChI=1S/C14H13N/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-14/h1-9,14-15H,10H2/t14-/m1/s1 |
| InChIKey | XZPFOJPRFUSEIH-CQSZACIVSA-N |
| XLogP | 3.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |