C16H17N — CID 3934310
2-(4-ethylphenyl)-2,3-dihydro-1H-indole (PubChem CID 3934310) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-2,3-dihydro-1H-indole.
| Compound Name | 2-(4-ethylphenyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 3934310 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2-(4-ethylphenyl)-2,3-dihydro-1H-indole |
| SMILES | CCc1ccc(C2Cc3ccccc3N2)cc1 |
| InChI | InChI=1S/C16H17N/c1-2-12-7-9-13(10-8-12)16-11-14-5-3-4-6-15(14)17-16/h3-10,16-17H,2,11H2,1H3 |
| InChIKey | PQZHKWVTWPSJAT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |