C17H16F3N — CID 3578191
2-(4-ethylphenyl)-7-(trifluoromethyl)-2,3-dihydro-1H-indole (PubChem CID 3578191) has the molecular formula C17H16F3N and a molecular weight of 291.32 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-7-(trifluoromethyl)-2,3-dihydro-1H-indole.
| Compound Name | 2-(4-ethylphenyl)-7-(trifluoromethyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 3578191 |
| Molecular Formula | C17H16F3N |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-(4-ethylphenyl)-7-(trifluoromethyl)-2,3-dihydro-1H-indole |
| SMILES | CCc1ccc(C2Cc3cccc(C(F)(F)F)c3N2)cc1 |
| InChI | InChI=1S/C17H16F3N/c1-2-11-6-8-12(9-7-11)15-10-13-4-3-5-14(16(13)21-15)17(18,19)20/h3-9,15,21H,2,10H2,1H3 |
| InChIKey | ZSUHWKJFUMQFCW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |