C20H25N — CID 5134941
2-(4-tert-butylphenyl)-5-ethyl-2,3-dihydro-1H-indole (PubChem CID 5134941) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-5-ethyl-2,3-dihydro-1H-indole.
| Compound Name | 2-(4-tert-butylphenyl)-5-ethyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 5134941 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 2-(4-tert-butylphenyl)-5-ethyl-2,3-dihydro-1H-indole |
| SMILES | CCc1ccc2c(c1)CC(c1ccc(C(C)(C)C)cc1)N2 |
| InChI | InChI=1S/C20H25N/c1-5-14-6-11-18-16(12-14)13-19(21-18)15-7-9-17(10-8-15)20(2,3)4/h6-12,19,21H,5,13H2,1-4H3 |
| InChIKey | PIQGXZNVCCAIAQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |