C14H13NO2 — CID 84691197
2-(4-hydroxyphenyl)-2,3-dihydro-1H-indol-5-ol (PubChem CID 84691197) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-2,3-dihydro-1H-indol-5-ol.
| Compound Name | 2-(4-hydroxyphenyl)-2,3-dihydro-1H-indol-5-ol |
|---|---|
| PubChem CID | 84691197 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-(4-hydroxyphenyl)-2,3-dihydro-1H-indol-5-ol |
| SMILES | Oc1ccc(C2Cc3cc(O)ccc3N2)cc1 |
| InChI | InChI=1S/C14H13NO2/c16-11-3-1-9(2-4-11)14-8-10-7-12(17)5-6-13(10)15-14/h1-7,14-17H,8H2 |
| InChIKey | KOSHIUBYJJAOFS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|