C9H9F2NO — CID 84659924
2-(difluoromethyl)-2,3-dihydro-1H-indol-5-ol (PubChem CID 84659924) has the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. Its IUPAC name is 2-(difluoromethyl)-2,3-dihydro-1H-indol-5-ol.
| Compound Name | 2-(difluoromethyl)-2,3-dihydro-1H-indol-5-ol |
|---|---|
| PubChem CID | 84659924 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 2-(difluoromethyl)-2,3-dihydro-1H-indol-5-ol |
| SMILES | Oc1ccc2c(c1)CC(C(F)F)N2 |
| InChI | InChI=1S/C9H9F2NO/c10-9(11)8-4-5-3-6(13)1-2-7(5)12-8/h1-3,8-9,12-13H,4H2 |
| InChIKey | IOQAAEHELLVBCJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|