C11H14FN — CID 82276851
5-fluoro-2-propan-2-yl-2,3-dihydro-1H-indole (PubChem CID 82276851) has the molecular formula C11H14FN and a molecular weight of 179.24 g/mol. Its IUPAC name is 5-fluoro-2-propan-2-yl-2,3-dihydro-1H-indole.
| Compound Name | 5-fluoro-2-propan-2-yl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 82276851 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 5-fluoro-2-propan-2-yl-2,3-dihydro-1H-indole |
| SMILES | CC(C)C1Cc2cc(F)ccc2N1 |
| InChI | InChI=1S/C11H14FN/c1-7(2)11-6-8-5-9(12)3-4-10(8)13-11/h3-5,7,11,13H,6H2,1-2H3 |
| InChIKey | PHRNFNLVKWHLPE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |